CAS 1417421-99-8 is the registry number for 3-BROMO-5-FLUORO-1-TOSYL-1H-PYRROLO[2,3-B]PYRIDINE, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 1417421-99-8) is a chemical compound with the molecular formula C14H10BrFN2O2S and a molecular weight of 369.21 g/mol. IUPAC name: 3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: XAAFAPOSALSONG-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFN2O2S |
|---|---|
| Molecular weight | 369.21 g/mol |
| IUPAC name | 3-bromo-5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | XAAFAPOSALSONG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2N=CC(=C3)F)Br |
Computed by PubChem (NCBI)