Products 1417440-37-9
CAS 1417440-37-9 appears in our catalog under these names: BNS, BNS, 96.17%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 5 mg.
2-[3-hydroxy-2-[2-(naphthalen-2-ylmethylsulfonyl)acetyl]imino-1,3-thiazol-4-yl]acetic acid (CAS 1417440-37-9) is a chemical compound with the molecular formula C18H16N2O6S2 and a molecular weight of 420.5 g/mol. IUPAC name: 2-[3-hydroxy-2-[2-(naphthalen-2-ylmethylsulfonyl)acetyl]imino-1,3-thiazol-4-yl]acetic acid. InChIKey: QNCNQHCDQMPPGD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6S2 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-[3-hydroxy-2-[2-(naphthalen-2-ylmethylsulfonyl)acetyl]imino-1,3-thiazol-4-yl]acetic acid |
| InChIKey | QNCNQHCDQMPPGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CS(=O)(=O)CC(=O)N=C3N(C(=CS3)CC(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
BNS, orb1700979