CAS 1417508-42-9 is the registry number for Trimethyl((2-(trifluoromethoxy)phenyl)ethynyl)silane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Trimethyl-[2-[2-(trifluoromethoxy)phenyl]ethynyl]silane (CAS 1417508-42-9) is a chemical compound with the molecular formula C12H13F3OSi and a molecular weight of 258.31 g/mol. IUPAC name: trimethyl-[2-[2-(trifluoromethoxy)phenyl]ethynyl]silane. InChIKey: OMLZFVWWDCJWNG-UHFFFAOYSA-N.
| Molecular formula | C12H13F3OSi |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | trimethyl-[2-[2-(trifluoromethoxy)phenyl]ethynyl]silane |
| InChIKey | OMLZFVWWDCJWNG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC=CC=C1OC(F)(F)F |
Computed by PubChem (NCBI)