CAS 1417519-79-9 appears in our catalog under these names: 3-Bromo-2-(4-fluorophenyl)pyridine, 95%, 3-Bromo-2-(4-fluorophenyl)pyridine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
3-bromo-2-(4-fluorophenyl)pyridine (CAS 1417519-79-9) is a chemical compound with the molecular formula C11H7BrFN and a molecular weight of 252.08 g/mol. IUPAC name: 3-bromo-2-(4-fluorophenyl)pyridine. InChIKey: IPSHOAWCCYABTN-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFN |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | 3-bromo-2-(4-fluorophenyl)pyridine |
| InChIKey | IPSHOAWCCYABTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)