Products 1417551-44-0
CAS 1417551-44-0 is the registry number for tert-Butyl (4-formylbicyclo[2.2.1]heptan-1-yl)carbamate, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
Tert-butyl N-(4-formyl-1-bicyclo[2.2.1]heptanyl)carbamate (CAS 1417551-44-0) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl N-(4-formyl-1-bicyclo[2.2.1]heptanyl)carbamate. InChIKey: GRGSQBNFEDSFIU-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl N-(4-formyl-1-bicyclo[2.2.1]heptanyl)carbamate |
| InChIKey | GRGSQBNFEDSFIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(C1)(CC2)C=O |
Computed by PubChem (NCBI)