Products 1417567-37-3
CAS 1417567-37-3 is the registry number for 2-Fluoro-1-(trifluoromethoxy)-3-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 500mg, 5g.
2-fluoro-1-(trifluoromethoxy)-3-(trifluoromethyl)benzene (CAS 1417567-37-3) is a chemical compound with the molecular formula C8H3F7O and a molecular weight of 248.10 g/mol. IUPAC name: 2-fluoro-1-(trifluoromethoxy)-3-(trifluoromethyl)benzene. InChIKey: QLXWMLUQVWQWHE-UHFFFAOYSA-N.
| Molecular formula | C8H3F7O |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-fluoro-1-(trifluoromethoxy)-3-(trifluoromethyl)benzene |
| InChIKey | QLXWMLUQVWQWHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)