Products 1417567-53-3

CAS 1417567-53-3 is the registry number for 4-(2-Furoyl)piperazine-1-carboximidamide sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid (CAS 1417567-53-3) is a chemical compound with the molecular formula C10H16N4O6S and a molecular weight of 320.32 g/mol. IUPAC name: 4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid. InChIKey: NARRLHLTVVEFSY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N4O6S
Molecular weight320.32 g/mol
IUPAC name4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid
InChIKeyNARRLHLTVVEFSY-UHFFFAOYSA-N
SMILESC1CN(CCN1C(=O)C2=CC=CO2)C(=N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)