CAS 1417568-62-7 is the registry number for 4-(1,3-Benzodioxol-5-ylmethyl)piperazine-1-carboximidamide sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboximidamide;sulfuric acid (CAS 1417568-62-7) is a chemical compound with the molecular formula C13H20N4O6S and a molecular weight of 360.39 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboximidamide;sulfuric acid. InChIKey: WLXVJCWBSSCMRK-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O6S |
|---|---|
| Molecular weight | 360.39 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboximidamide;sulfuric acid |
| InChIKey | WLXVJCWBSSCMRK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC3=C(C=C2)OCO3)C(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)