CAS 1417695-76-1 is the registry number for Maihuatini Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
7-(difluoromethoxy)-6-nitro-3H-quinazolin-4-one (CAS 1417695-76-1) is a chemical compound with the molecular formula C9H5F2N3O4 and a molecular weight of 257.15 g/mol. IUPAC name: 7-(difluoromethoxy)-6-nitro-3H-quinazolin-4-one. InChIKey: OKTHYIFMPRIMNI-UHFFFAOYSA-N.
| Molecular formula | C9H5F2N3O4 |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 7-(difluoromethoxy)-6-nitro-3H-quinazolin-4-one |
| InChIKey | OKTHYIFMPRIMNI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])OC(F)F)N=CNC2=O |
Computed by PubChem (NCBI)