CAS 1417695-78-3 is the registry number for Maihuatini Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-(3-chloro-4-fluorophenyl)-7-(difluoromethoxy)quinazoline-4,6-diamine (CAS 1417695-78-3) is a chemical compound with the molecular formula C15H10ClF3N4O and a molecular weight of 354.71 g/mol. IUPAC name: 4-N-(3-chloro-4-fluorophenyl)-7-(difluoromethoxy)quinazoline-4,6-diamine. InChIKey: AEFLSQGQWUGTCG-UHFFFAOYSA-N.
| Molecular formula | C15H10ClF3N4O |
|---|---|
| Molecular weight | 354.71 g/mol |
| IUPAC name | 4-N-(3-chloro-4-fluorophenyl)-7-(difluoromethoxy)quinazoline-4,6-diamine |
| InChIKey | AEFLSQGQWUGTCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC=NC3=CC(=C(C=C32)N)OC(F)F)Cl)F |
Computed by PubChem (NCBI)