CAS 14177-81-2 is the registry number for Diphenhydramine Methiodide. Offered by: TRC. Available pack sizes: 500mg.
2-benzhydryloxyethyl(trimethyl)azanium iodide (CAS 14177-81-2) is a chemical compound with the molecular formula C18H24INO and a molecular weight of 397.3 g/mol. IUPAC name: 2-benzhydryloxyethyl(trimethyl)azanium iodide. InChIKey: VBILFZZVVHHLOE-UHFFFAOYSA-M.
| Molecular formula | C18H24INO |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | 2-benzhydryloxyethyl(trimethyl)azanium iodide |
| InChIKey | VBILFZZVVHHLOE-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.[I-] |
Computed by PubChem (NCBI)