Products 141773-73-1

CAS 141773-73-1 is the registry number for 2-[1-(3,3-Dimethylcyclohexyl)ethoxy]-2-methylpropyl propionate, 90%+(NMR),RG, 90%+(NMR),RG. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl] propanoate (CAS 141773-73-1) is a chemical compound with the molecular formula C17H32O3 and a molecular weight of 284.4 g/mol. IUPAC name: [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl] propanoate. InChIKey: LSTSBZKIQFOPHA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H32O3
Molecular weight284.4 g/mol
IUPAC name[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl] propanoate
InChIKeyLSTSBZKIQFOPHA-UHFFFAOYSA-N
SMILESCCC(=O)OCC(C)(C)OC(C)C1CCCC(C1)(C)C

Computed by PubChem (NCBI)