Products 1417793-38-4
CAS 1417793-38-4 is the registry number for tert-Butyl 4-((6-nitroquinoxalin-2-yl)amino)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-[(6-nitroquinoxalin-2-yl)amino]piperidine-1-carboxylate (CAS 1417793-38-4) is a chemical compound with the molecular formula C18H23N5O4 and a molecular weight of 373.4 g/mol. IUPAC name: tert-butyl 4-[(6-nitroquinoxalin-2-yl)amino]piperidine-1-carboxylate. InChIKey: CAZAZUSDTDKVKE-UHFFFAOYSA-N.
| Molecular formula | C18H23N5O4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | tert-butyl 4-[(6-nitroquinoxalin-2-yl)amino]piperidine-1-carboxylate |
| InChIKey | CAZAZUSDTDKVKE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2=CN=C3C=C(C=CC3=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)