Products 1417793-66-8

CAS 1417793-66-8 is the registry number for 5-Nitro-2-(piperidin-4-ylthio)pyridine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-nitro-2-piperidin-4-ylsulfanylpyridine;hydrochloride (CAS 1417793-66-8) is a chemical compound with the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. IUPAC name: 5-nitro-2-piperidin-4-ylsulfanylpyridine;hydrochloride. InChIKey: CEURIYAUOQKIAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClN3O2S
Molecular weight275.76 g/mol
IUPAC name5-nitro-2-piperidin-4-ylsulfanylpyridine;hydrochloride
InChIKeyCEURIYAUOQKIAQ-UHFFFAOYSA-N
SMILESC1CNCCC1SC2=NC=C(C=C2)[N+](=O)[O-].Cl

Computed by PubChem (NCBI)