Products 1417805-17-4
CAS 1417805-17-4 is the registry number for Albatrelin C. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5-dimethylchromen-7-ol (CAS 1417805-17-4) is a chemical compound with the molecular formula C22H30O2 and a molecular weight of 326.5 g/mol. IUPAC name: 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5-dimethylchromen-7-ol. InChIKey: QJCFVYYUAJZBKT-LICLKQGHSA-N.
| Molecular formula | C22H30O2 |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,5-dimethylchromen-7-ol |
| InChIKey | QJCFVYYUAJZBKT-LICLKQGHSA-N |
| SMILES | CC1=CC(=CC2=C1C=CC(O2)(C)CC/C=C(\C)/CCC=C(C)C)O |
Computed by PubChem (NCBI)