CAS 1417823-63-2 is the registry number for TAU-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-chlorophenyl)-5-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]-1,2,4-thiadiazole (CAS 1417823-63-2) is a chemical compound with the molecular formula C20H20Cl2N4S and a molecular weight of 419.4 g/mol. IUPAC name: 3-(4-chlorophenyl)-5-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]-1,2,4-thiadiazole. InChIKey: VMNMAOFYRIIATE-UHFFFAOYSA-N.
| Molecular formula | C20H20Cl2N4S |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]-1,2,4-thiadiazole |
| InChIKey | VMNMAOFYRIIATE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=CC=C(C=C2)Cl)C3=NC(=NS3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)