Products 141797-92-4

CAS 141797-92-4 is the registry number for NS004, 99.67%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one (CAS 141797-92-4) is a chemical compound with the molecular formula C14H8ClF3N2O2 and a molecular weight of 328.67 g/mol. IUPAC name: 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one. InChIKey: WYLYBVMNGZOYOH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8ClF3N2O2
Molecular weight328.67 g/mol
IUPAC name3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one
InChIKeyWYLYBVMNGZOYOH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(F)(F)F)NC(=O)N2C3=C(C=CC(=C3)Cl)O

Computed by PubChem (NCBI)