CAS 141797-92-4 is the registry number for NS004, 99.67%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.
3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one (CAS 141797-92-4) is a chemical compound with the molecular formula C14H8ClF3N2O2 and a molecular weight of 328.67 g/mol. IUPAC name: 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one. InChIKey: WYLYBVMNGZOYOH-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N2O2 |
|---|---|
| Molecular weight | 328.67 g/mol |
| IUPAC name | 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| InChIKey | WYLYBVMNGZOYOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=O)N2C3=C(C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)