CAS 141807-30-9 is the registry number for Trifluoro-methanesulfonic acid 4-(2-tert-butoxycarbonylamino-ethyl)-phenyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate (CAS 141807-30-9) is a chemical compound with the molecular formula C14H18F3NO5S and a molecular weight of 369.36 g/mol. IUPAC name: [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate. InChIKey: QQRSFTFFNIRYNA-UHFFFAOYSA-N.
| Molecular formula | C14H18F3NO5S |
|---|---|
| Molecular weight | 369.36 g/mol |
| IUPAC name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate |
| InChIKey | QQRSFTFFNIRYNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)