CAS 141807-57-0 is the registry number for RTI-113, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
Phenyl (1R,2S,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 141807-57-0) is a chemical compound with the molecular formula C21H23Cl2NO2 and a molecular weight of 392.3 g/mol. IUPAC name: phenyl (1R,2S,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: UVNAYBAOZUMARC-TVEJVZOKSA-N.
| Molecular formula | C21H23Cl2NO2 |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | phenyl (1R,2S,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | UVNAYBAOZUMARC-TVEJVZOKSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC=C(C=C3)Cl)C(=O)OC4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)