CAS 1418095-09-6 appears in our catalog under these names: Dimethenamid ESA Sodium Salt, Dimethenamid-ethane sulfonic acid (ESA) sodium, Dimethenamid-ethane sulfonic acid (ESA) sodium 100 µg/mL in Methanol, Dimethenamid ESA sodium salt, Concentration: 10.0 µg/ml Solvent: Acetonitrile, Dimethenamid-P ESA sodium salt. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 50mg, 5mg, 25mg, 1ml, 100mg, 1x25mg, 1x10ml, 1x10mg.
Sodium 2-[(2,4-dimethylthiophen-3-yl)-(1-methoxypropan-2-yl)amino]-2-oxoethanesulfonate (CAS 1418095-09-6) is a chemical compound with the molecular formula C12H18NNaO5S2 and a molecular weight of 343.4 g/mol. IUPAC name: sodium 2-[(2,4-dimethylthiophen-3-yl)-(1-methoxypropan-2-yl)amino]-2-oxoethanesulfonate. InChIKey: JVZHSWHMSOBMSF-UHFFFAOYSA-M.
| Molecular formula | C12H18NNaO5S2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | sodium 2-[(2,4-dimethylthiophen-3-yl)-(1-methoxypropan-2-yl)amino]-2-oxoethanesulfonate |
| InChIKey | JVZHSWHMSOBMSF-UHFFFAOYSA-M |
| SMILES | CC1=CSC(=C1N(C(C)COC)C(=O)CS(=O)(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)