CAS 1418095-27-8 is the registry number for 2-(3-Carbamoyl-1-((6-chloropyridin-3-yl)methyl)ureido)ethanesulfonic Acid. Offered by: TRC. Available pack sizes: 25mg.
2-[carbamoylcarbamoyl-[(6-chloro-3-pyridinyl)methyl]amino]ethanesulfonic acid (CAS 1418095-27-8) is a chemical compound with the molecular formula C10H13ClN4O5S and a molecular weight of 336.75 g/mol. IUPAC name: 2-[carbamoylcarbamoyl-[(6-chloro-3-pyridinyl)methyl]amino]ethanesulfonic acid. InChIKey: UCZRQNICFJGZAI-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4O5S |
|---|---|
| Molecular weight | 336.75 g/mol |
| IUPAC name | 2-[carbamoylcarbamoyl-[(6-chloro-3-pyridinyl)methyl]amino]ethanesulfonic acid |
| InChIKey | UCZRQNICFJGZAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CN(CCS(=O)(=O)O)C(=O)NC(=O)N)Cl |
Computed by PubChem (NCBI)