CAS 1418095-28-9 appears in our catalog under these names: 6-(2,2,2-Trifluoroethoxy)-1,3,5-Triazine-2,4-diamine, Triflusulfuron-methyl metabolite IN-M7222, Triflusulfuron-methyl metabolite IN-M7222 100 µg/mL in Acetone, 1,3,5-Triazine-2,4-diamine, Triflusulfuron Metabolite IN-M7222. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 500mg, 25mg, 1ml, 250mg, 100mg, 1x10mg, 1x1ml.
6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (CAS 1418095-28-9) is a chemical compound with the molecular formula C5H6F3N5O and a molecular weight of 209.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine. InChIKey: HJZAYYJWOHOQSM-UHFFFAOYSA-N.
| Molecular formula | C5H6F3N5O |
|---|---|
| Molecular weight | 209.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| InChIKey | HJZAYYJWOHOQSM-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC1=NC(=NC(=N1)N)N |
Computed by PubChem (NCBI)