CAS 1418127-43-1 is the registry number for 4,6-Dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1418127-43-1) is a chemical compound with the molecular formula C10H13BCl2N2O2 and a molecular weight of 274.94 g/mol. IUPAC name: 4,6-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: JDMUKBDXLDTDTD-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2N2O2 |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 4,6-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | JDMUKBDXLDTDTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)