CAS 1418129-38-0 appears in our catalog under these names: 4-Formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 95%, 4-Formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1418129-38-0) is a chemical compound with the molecular formula C14H17BO5 and a molecular weight of 276.09 g/mol. IUPAC name: 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: MUDUXFQBPOSXHF-UHFFFAOYSA-N.
| Molecular formula | C14H17BO5 |
|---|---|
| Molecular weight | 276.09 g/mol |
| IUPAC name | 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | MUDUXFQBPOSXHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)O)C=O |
Computed by PubChem (NCBI)