CAS 1418132-87-2 is the registry number for 1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-yl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea (CAS 1418132-87-2) is a chemical compound with the molecular formula C12H18BN3O3 and a molecular weight of 263.10 g/mol. IUPAC name: [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea. InChIKey: GHUDUGAWIUNUQI-UHFFFAOYSA-N.
| Molecular formula | C12H18BN3O3 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea |
| InChIKey | GHUDUGAWIUNUQI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)NC(=O)N |
Computed by PubChem (NCBI)