CAS 1418293-40-9 appears in our catalog under these names: NT160, 98%, NT160, NT160, 99.58%, (R)-N-(1-(Benzyl(methyl)amino)propan-2-yl)-4-(5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzamide, 98%, 98%. Offered by: AmBeed, GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mM (in 1ml dmso), 10 mg, 100 mg, 25 mg, 10mM/1mL, 50 mg.
N-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (CAS 1418293-40-9) is a chemical compound with the molecular formula C21H21F3N4O2 and a molecular weight of 418.4 g/mol. IUPAC name: N-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide. InChIKey: RESDVUQVZOJNSO-CQSZACIVSA-N.
| Molecular formula | C21H21F3N4O2 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | N-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| InChIKey | RESDVUQVZOJNSO-CQSZACIVSA-N |
| SMILES | C[C@H](CN(C)CC1=CC=CC=C1)NC(=O)C2=CC=C(C=C2)C3=NOC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)