CAS 141899-24-3 is the registry number for RTI-55 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl (1R,2S,3S,5S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 141899-24-3) is a chemical compound with the molecular formula C16H21ClINO2 and a molecular weight of 421.70 g/mol. IUPAC name: methyl (1R,2S,3S,5S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: FGRGHXZCDYBEJE-PEVLCXCCSA-N.
| Molecular formula | C16H21ClINO2 |
|---|---|
| Molecular weight | 421.70 g/mol |
| IUPAC name | methyl (1R,2S,3S,5S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | FGRGHXZCDYBEJE-PEVLCXCCSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC=C(C=C3)I)C(=O)OC.Cl |
Computed by PubChem (NCBI)