CAS 14191-90-3 is the registry number for L-Norarginine. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2-amino-4-(diaminomethylideneamino)butanoic acid (CAS 14191-90-3) is a chemical compound with the molecular formula C5H12N4O2 and a molecular weight of 160.17 g/mol. IUPAC name: (2S)-2-amino-4-(diaminomethylideneamino)butanoic acid. InChIKey: IFPQOXNWLSRZKX-VKHMYHEASA-N.
| Molecular formula | C5H12N4O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2S)-2-amino-4-(diaminomethylideneamino)butanoic acid |
| InChIKey | IFPQOXNWLSRZKX-VKHMYHEASA-N |
| SMILES | C(CN=C(N)N)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)