Products 1419221-36-5
CAS 1419221-36-5 is the registry number for N-(Pyrimidin-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-pyrimidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1419221-36-5) is a chemical compound with the molecular formula C17H20BN3O3 and a molecular weight of 325.2 g/mol. IUPAC name: N-pyrimidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: APCITVGUELDPGZ-UHFFFAOYSA-N.
| Molecular formula | C17H20BN3O3 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | N-pyrimidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | APCITVGUELDPGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3=NC=NC=C3 |
Computed by PubChem (NCBI)