CAS 1419705-13-7 is the registry number for (4E, 8E)-Sphingadienine-C18-1-phosphate. Offered by: TRC, Biosynth. Available pack sizes: 0,25mg, 1mg, 5mg, 10mg, 25mg, 50mg.
CAS 1419705-13-7 identifies a chemical compound with the molecular formula C23H32O6 and a molecular weight of 404.5 g/mol. InChIKey: VVVBIGJTQWJCHV-VLESFSHWSA-N.
| Molecular formula | C23H32O6 |
|---|---|
| Molecular weight | 404.5 g/mol |
| InChIKey | VVVBIGJTQWJCHV-VLESFSHWSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@]45C6(COCO6)OCO5)C)O |
Computed by PubChem (NCBI)