CAS 1419748-26-7 is the registry number for 2-(Benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1419748-26-7) is a chemical compound with the molecular formula C20H22BNO3 and a molecular weight of 335.2 g/mol. IUPAC name: 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: SPEKRPUAZCDTIT-UHFFFAOYSA-N.
| Molecular formula | C20H22BNO3 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | SPEKRPUAZCDTIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)