CAS 14199-83-8 appears in our catalog under these names: 1-Deoxy-1-nitro-d-mannitol, 98%, 1-DEOXY-1-NITRO-D-MANNITOL. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
(2R,3R,4R,5R)-6-nitrohexane-1,2,3,4,5-pentol (CAS 14199-83-8) is a chemical compound with the molecular formula C6H13NO7 and a molecular weight of 211.17 g/mol. IUPAC name: (2R,3R,4R,5R)-6-nitrohexane-1,2,3,4,5-pentol. InChIKey: HOFCJTOUEGMYBT-KVTDHHQDSA-N.
| Molecular formula | C6H13NO7 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | (2R,3R,4R,5R)-6-nitrohexane-1,2,3,4,5-pentol |
| InChIKey | HOFCJTOUEGMYBT-KVTDHHQDSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)