CAS 1420294-70-7 is the registry number for Benzyl ((5,5-dichloro-6-oxospiro[3.3]heptan-2-yl)methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(3,3-dichloro-2-oxospiro[3.3]heptan-6-yl)methyl]carbamate (CAS 1420294-70-7) is a chemical compound with the molecular formula C16H17Cl2NO3 and a molecular weight of 342.2 g/mol. IUPAC name: benzyl N-[(3,3-dichloro-2-oxospiro[3.3]heptan-6-yl)methyl]carbamate. InChIKey: DTARTVYFYSYUJY-UHFFFAOYSA-N.
| Molecular formula | C16H17Cl2NO3 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | benzyl N-[(3,3-dichloro-2-oxospiro[3.3]heptan-6-yl)methyl]carbamate |
| InChIKey | DTARTVYFYSYUJY-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(=O)C2(Cl)Cl)CNC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)