CAS 1420780-21-7 is the registry number for N-(4-Bromobenzyl)-N-tosyl-D-alaninol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[(4-bromophenyl)methyl]-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide (CAS 1420780-21-7) is a chemical compound with the molecular formula C17H20BrNO3S and a molecular weight of 398.3 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide. InChIKey: HYEXJIIGEVMPAZ-CQSZACIVSA-N.
| Molecular formula | C17H20BrNO3S |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide |
| InChIKey | HYEXJIIGEVMPAZ-CQSZACIVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)Br)[C@H](C)CO |
Computed by PubChem (NCBI)