CAS 14208-42-5 is the registry number for Dineophyltin Dichloride. Offered by: TRC. Available pack sizes: 1g.
Dichloro-bis(2-methyl-2-phenylpropyl)stannane (CAS 14208-42-5) is a chemical compound with the molecular formula C20H26Cl2Sn and a molecular weight of 456.0 g/mol. IUPAC name: dichloro-bis(2-methyl-2-phenylpropyl)stannane. InChIKey: DAUATJOQJOPFPF-UHFFFAOYSA-L.
| Molecular formula | C20H26Cl2Sn |
|---|---|
| Molecular weight | 456.0 g/mol |
| IUPAC name | dichloro-bis(2-methyl-2-phenylpropyl)stannane |
| InChIKey | DAUATJOQJOPFPF-UHFFFAOYSA-L |
| SMILES | CC(C)(C[Sn](CC(C)(C)C1=CC=CC=C1)(Cl)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)