Products 1420800-37-8
CAS 1420800-37-8 is the registry number for 3-Bromo-4-(ethylamino)-5-nitrobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-bromo-4-(ethylamino)-5-nitrobenzonitrile (CAS 1420800-37-8) is a chemical compound with the molecular formula C9H8BrN3O2 and a molecular weight of 270.08 g/mol. IUPAC name: 3-bromo-4-(ethylamino)-5-nitrobenzonitrile. InChIKey: QDOQBNSEYVUOSV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O2 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 3-bromo-4-(ethylamino)-5-nitrobenzonitrile |
| InChIKey | QDOQBNSEYVUOSV-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1Br)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)