Products 1420804-56-3

CAS 1420804-56-3 is the registry number for 3-Methoxypropyl Z-L-Alaninamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate (CAS 1420804-56-3) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: benzyl N-[(2S)-1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate. InChIKey: SAVSELWCSLOACS-LBPRGKRZSA-N.

Identity
Molecular formulaC15H22N2O4
Molecular weight294.35 g/mol
IUPAC namebenzyl N-[(2S)-1-(3-methoxypropylamino)-1-oxopropan-2-yl]carbamate
InChIKeySAVSELWCSLOACS-LBPRGKRZSA-N
SMILESC[C@@H](C(=O)NCCCOC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)