CAS 1420871-78-8 is the registry number for N1-(5-Chloropyrimidin-2-yl)cyclohexane-1,2-diamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-N-(5-chloropyrimidin-2-yl)cyclohexane-1,2-diamine;hydrochloride (CAS 1420871-78-8) is a chemical compound with the molecular formula C10H16Cl2N4 and a molecular weight of 263.16 g/mol. IUPAC name: 2-N-(5-chloropyrimidin-2-yl)cyclohexane-1,2-diamine;hydrochloride. InChIKey: AQLHBJZNJCDGBX-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N4 |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 2-N-(5-chloropyrimidin-2-yl)cyclohexane-1,2-diamine;hydrochloride |
| InChIKey | AQLHBJZNJCDGBX-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)N)NC2=NC=C(C=N2)Cl.Cl |
Computed by PubChem (NCBI)