CAS 1420880-42-7 is the registry number for 4’-Bromomethyl-2-cyanobiphenyl-d4. Offered by: TRC. Available pack sizes: 250mg.
2-[4-(bromomethyl)-2,3,5,6-tetradeuteriophenyl]benzonitrile (CAS 1420880-42-7) is a chemical compound with the molecular formula C14H10BrN and a molecular weight of 276.16 g/mol. IUPAC name: 2-[4-(bromomethyl)-2,3,5,6-tetradeuteriophenyl]benzonitrile. InChIKey: LFFIEVAMVPCZNA-KDWZCNHSSA-N.
| Molecular formula | C14H10BrN |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-[4-(bromomethyl)-2,3,5,6-tetradeuteriophenyl]benzonitrile |
| InChIKey | LFFIEVAMVPCZNA-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CBr)[2H])[2H])C2=CC=CC=C2C#N)[2H] |
Computed by PubChem (NCBI)