CAS 1420885-98-8 is the registry number for 4-Chloro-2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrrolo(2,3-b)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1420885-98-8) is a chemical compound with the molecular formula C14H7ClF4N2 and a molecular weight of 314.66 g/mol. IUPAC name: 4-chloro-2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: YNUOOLDEBSLIDP-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF4N2 |
|---|---|
| Molecular weight | 314.66 g/mol |
| IUPAC name | 4-chloro-2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | YNUOOLDEBSLIDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(C(=CN=C3N2)C(F)(F)F)Cl)F |
Computed by PubChem (NCBI)