Products 1420985-13-2
CAS 1420985-13-2 is the registry number for 1-(5-Nitropyridin-2-yl)-1,4-diazepane hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-nitro-2-pyridinyl)-1,4-diazepane;hydrochloride (CAS 1420985-13-2) is a chemical compound with the molecular formula C10H15ClN4O2 and a molecular weight of 258.70 g/mol. IUPAC name: 1-(5-nitro-2-pyridinyl)-1,4-diazepane;hydrochloride. InChIKey: LEFOXQOEKVNQAM-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN4O2 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 1-(5-nitro-2-pyridinyl)-1,4-diazepane;hydrochloride |
| InChIKey | LEFOXQOEKVNQAM-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)