CAS 1421227-96-4 is the registry number for Etoricoxib Impurity 5 Lithium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 2-(4-methylsulfonylphenyl)acetate (CAS 1421227-96-4) is a chemical compound with the molecular formula C9H9LiO4S and a molecular weight of 220.2 g/mol. IUPAC name: lithium 2-(4-methylsulfonylphenyl)acetate. InChIKey: JDRGJANUOSIAKA-UHFFFAOYSA-M.
| Molecular formula | C9H9LiO4S |
|---|---|
| Molecular weight | 220.2 g/mol |
| IUPAC name | lithium 2-(4-methylsulfonylphenyl)acetate |
| InChIKey | JDRGJANUOSIAKA-UHFFFAOYSA-M |
| SMILES | [Li+].CS(=O)(=O)C1=CC=C(C=C1)CC(=O)[O-] |
Computed by PubChem (NCBI)