CAS 1421254-91-2 is the registry number for Trans-4-(dimethylamino)-3-pyrrolidinol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(3S,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride (CAS 1421254-91-2) is a chemical compound with the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. IUPAC name: (3S,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride. InChIKey: DZLFLRAVIZGQMT-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2O |
|---|---|
| Molecular weight | 203.11 g/mol |
| IUPAC name | (3S,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride |
| InChIKey | DZLFLRAVIZGQMT-USPAICOZSA-N |
| SMILES | CN(C)[C@H]1CNC[C@@H]1O.Cl.Cl |
Computed by PubChem (NCBI)