CAS 1421283-61-5 appears in our catalog under these names: Gestodene EP Impurity K (Aromatic 6-Keto Gestodene), Gestodene Impurity 11（Gestodene EP Impurity K）, Aromatic 6-Keto Gestodene. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8R,9S,13S,14S,17R)-13-ethyl-17-ethynyl-3,17-dihydroxy-7,8,9,11,12,14-hexahydrocyclopenta[a]phenanthren-6-one (CAS 1421283-61-5) is a chemical compound with the molecular formula C21H22O3 and a molecular weight of 322.4 g/mol. IUPAC name: (8R,9S,13S,14S,17R)-13-ethyl-17-ethynyl-3,17-dihydroxy-7,8,9,11,12,14-hexahydrocyclopenta[a]phenanthren-6-one. InChIKey: IUNCDFJNZLBAAQ-WDMKGZBDSA-N.
| Molecular formula | C21H22O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17R)-13-ethyl-17-ethynyl-3,17-dihydroxy-7,8,9,11,12,14-hexahydrocyclopenta[a]phenanthren-6-one |
| InChIKey | IUNCDFJNZLBAAQ-WDMKGZBDSA-N |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1C=C[C@]2(C#C)O)CC(=O)C4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)