CAS 14213-11-7 appears in our catalog under these names: 1-(4-Nitrophenyl)-1h-1,2,3,4-tetrazole, 98%, 98%, 1-(4-Nitrophenyl)-1h-1,2,3,4-tetrazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-(4-nitrophenyl)tetrazole (CAS 14213-11-7) is a chemical compound with the molecular formula C7H5N5O2 and a molecular weight of 191.15 g/mol. IUPAC name: 1-(4-nitrophenyl)tetrazole. InChIKey: NHYHTYJIILODSA-UHFFFAOYSA-N.
| Molecular formula | C7H5N5O2 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 1-(4-nitrophenyl)tetrazole |
| InChIKey | NHYHTYJIILODSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NN=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)