CAS 1421313-26-9 appears in our catalog under these names: 3'-O-Sulfate-Epicatechin Ammonium Salt, 3'-O-Sulfate-epicatechin ammonium. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 0,5mg, 2mg.
Azane;[2-hydroxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate (CAS 1421313-26-9) is a chemical compound with the molecular formula C15H17NO9S and a molecular weight of 387.4 g/mol. IUPAC name: azane;[2-hydroxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate. InChIKey: ZJMCYUJOROGUAT-XRZFDKQNSA-N.
| Molecular formula | C15H17NO9S |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | azane;[2-hydroxy-5-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]phenyl] hydrogen sulfate |
| InChIKey | ZJMCYUJOROGUAT-XRZFDKQNSA-N |
| SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)OS(=O)(=O)O)O.N |
Computed by PubChem (NCBI)