CAS 1421347-21-8 is the registry number for Potassium Trifluoro(5-methoxy-2-pyridinyl)-borate. Offered by: TRC. Available pack sizes: 1g.
Potassium trifluoro-(5-methoxy-2-pyridinyl)boranuide (CAS 1421347-21-8) is a chemical compound with the molecular formula C6H6BF3KNO and a molecular weight of 215.02 g/mol. IUPAC name: potassium trifluoro-(5-methoxy-2-pyridinyl)boranuide. InChIKey: LSLJGGPCKFUUQG-UHFFFAOYSA-N.
| Molecular formula | C6H6BF3KNO |
|---|---|
| Molecular weight | 215.02 g/mol |
| IUPAC name | potassium trifluoro-(5-methoxy-2-pyridinyl)boranuide |
| InChIKey | LSLJGGPCKFUUQG-UHFFFAOYSA-N |
| SMILES | [B-](C1=NC=C(C=C1)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)