Products 1421464-74-5
CAS 1421464-74-5 is the registry number for LasR antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1,2-benzoxazol-3-yl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide (CAS 1421464-74-5) is a chemical compound with the molecular formula C20H15F3N2O3 and a molecular weight of 388.3 g/mol. IUPAC name: 2-(1,2-benzoxazol-3-yl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide. InChIKey: WQIHKETXORTEHU-UHFFFAOYSA-N.
| Molecular formula | C20H15F3N2O3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 2-(1,2-benzoxazol-3-yl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide |
| InChIKey | WQIHKETXORTEHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)CC(=O)NCC#CCOC3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)