CAS 1421599-23-6 appears in our catalog under these names: 3-(3-(9H-Carbazol-9-yl)phenyl)benzo[4,5]thieno[2,3-b]pyridine, 99%, 3-(3-(9H-Carbazol-9-yl)phenyl)benzo[4,5]thieno[2,3-b]pyridine, 97%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(2,5-p -xylene)). Offered by: Lumtec, Chemat Brand. Available pack sizes: 1g, 2g, on request.
3-(3-carbazol-9-ylphenyl)-[1]benzothiolo[2,3-b]pyridine (CAS 1421599-23-6) is a chemical compound with the molecular formula C29H18N2S and a molecular weight of 426.5 g/mol. IUPAC name: 3-(3-carbazol-9-ylphenyl)-[1]benzothiolo[2,3-b]pyridine. InChIKey: MHSSVJANLFXJTO-UHFFFAOYSA-N.
| Molecular formula | C29H18N2S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 3-(3-carbazol-9-ylphenyl)-[1]benzothiolo[2,3-b]pyridine |
| InChIKey | MHSSVJANLFXJTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC(=C4)C5=CC6=C(N=C5)SC7=CC=CC=C76 |
Computed by PubChem (NCBI)