CAS 1421602-12-1 is the registry number for Pentafluorophenyl 4-methyl-1,3-thiazole-2-sulfonate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,3,4,5,6-pentafluorophenyl) 4-methyl-1,3-thiazole-2-sulfonate (CAS 1421602-12-1) is a chemical compound with the molecular formula C10H4F5NO3S2 and a molecular weight of 345.3 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 4-methyl-1,3-thiazole-2-sulfonate. InChIKey: AEVLNSYJKMQNMI-UHFFFAOYSA-N.
| Molecular formula | C10H4F5NO3S2 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 4-methyl-1,3-thiazole-2-sulfonate |
| InChIKey | AEVLNSYJKMQNMI-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)